C21H24N2O3S — CID 28591837
N-cycloheptyl-2-(5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide (PubChem CID 28591837) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-cycloheptyl-2-(5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide.
| Compound Name | N-cycloheptyl-2-(5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 28591837 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-cycloheptyl-2-(5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide |
| SMILES | O=C(CN1c2ccccc2-c2ccccc2S1(=O)=O)NC1CCCCCC1 |
| InChI | InChI=1S/C21H24N2O3S/c24-21(22-16-9-3-1-2-4-10-16)15-23-19-13-7-5-11-17(19)18-12-6-8-14-20(18)27(23,25)26/h5-8,11-14,16H,1-4,9-10,15H2,(H,22,24) |
| InChIKey | KSPXJUFPPVXWQK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |