C17H16N2O3S — CID 28591725
N-cyclopropyl-2-(5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide (PubChem CID 28591725) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-cyclopropyl-2-(5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide.
| Compound Name | N-cyclopropyl-2-(5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide |
|---|---|
| PubChem CID | 28591725 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-cyclopropyl-2-(5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)acetamide |
| SMILES | O=C(CN1c2ccccc2-c2ccccc2S1(=O)=O)NC1CC1 |
| InChI | InChI=1S/C17H16N2O3S/c20-17(18-12-9-10-12)11-19-15-7-3-1-5-13(15)14-6-2-4-8-16(14)23(19,21)22/h1-8,12H,9-11H2,(H,18,20) |
| InChIKey | LQNLRBLKCCLNGQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |