C13H18N4O3S — CID 107342889
6-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)hexanehydrazide (PubChem CID 107342889) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 6-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)hexanehydrazide.
| Compound Name | 6-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)hexanehydrazide |
|---|---|
| PubChem CID | 107342889 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 6-(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)hexanehydrazide |
| SMILES | NNC(=O)CCCCCN1C=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H18N4O3S/c14-16-13(18)8-2-1-5-9-17-10-15-21(19,20)12-7-4-3-6-11(12)17/h3-4,6-7,10H,1-2,5,8-9,14H2,(H,16,18) |
| InChIKey | PITITDPUVPEWPL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|