C16H14N2O4S — CID 175523929
methyl 4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]benzoate (PubChem CID 175523929) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is methyl 4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]benzoate.
| Compound Name | methyl 4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]benzoate |
|---|---|
| PubChem CID | 175523929 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | methyl 4-[(1,1-dioxo-1λ6,2,4-benzothiadiazin-4-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C16H14N2O4S/c1-22-16(19)13-8-6-12(7-9-13)10-18-11-17-23(20,21)15-5-3-2-4-14(15)18/h2-9,11H,10H2,1H3 |
| InChIKey | YDACVPHRAXDYTG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |