C17H15NO4 — CID 17047028
methyl 4-[(3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate (PubChem CID 17047028) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl 4-[(3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate.
| Compound Name | methyl 4-[(3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate |
|---|---|
| PubChem CID | 17047028 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | methyl 4-[(3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)COc3ccccc32)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-21-17(20)13-8-6-12(7-9-13)10-18-14-4-2-3-5-15(14)22-11-16(18)19/h2-9H,10-11H2,1H3 |
| InChIKey | JDORZQTYRQDOAD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |