C13H11NO2S — CID 54161143
4-(thiophen-3-ylmethyl)-1,4-benzoxazin-3-one (PubChem CID 54161143) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is 4-(thiophen-3-ylmethyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-(thiophen-3-ylmethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 54161143 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 4-(thiophen-3-ylmethyl)-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccccc2N1Cc1ccsc1 |
| InChI | InChI=1S/C13H11NO2S/c15-13-8-16-12-4-2-1-3-11(12)14(13)7-10-5-6-17-9-10/h1-6,9H,7-8H2 |
| InChIKey | OOMCSJNMTOGJBL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |