C14H12N2O2 — CID 14423586
4-(pyridin-2-ylmethyl)-1,4-benzoxazin-3-one (PubChem CID 14423586) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-(pyridin-2-ylmethyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-(pyridin-2-ylmethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 14423586 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 4-(pyridin-2-ylmethyl)-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccccc2N1Cc1ccccn1 |
| InChI | InChI=1S/C14H12N2O2/c17-14-10-18-13-7-2-1-6-12(13)16(14)9-11-5-3-4-8-15-11/h1-8H,9-10H2 |
| InChIKey | LHRCEWJAULJZPT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |