C14H13N3O2 — CID 14423588
6-amino-4-(pyridin-2-ylmethyl)-1,4-benzoxazin-3-one (PubChem CID 14423588) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 6-amino-4-(pyridin-2-ylmethyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-4-(pyridin-2-ylmethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 14423588 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 6-amino-4-(pyridin-2-ylmethyl)-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)N(Cc1ccccn1)C(=O)CO2 |
| InChI | InChI=1S/C14H13N3O2/c15-10-4-5-13-12(7-10)17(14(18)9-19-13)8-11-3-1-2-6-16-11/h1-7H,8-9,15H2 |
| InChIKey | CKNGRNZHJBQKNW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|