C14H12BrN3O2 — CID 79251552
4-[(4-amino-2-pyridinyl)methyl]-6-bromo-1,4-benzoxazin-3-one (PubChem CID 79251552) has the molecular formula C14H12BrN3O2 and a molecular weight of 334.17 g/mol. Its IUPAC name is 4-[(4-amino-2-pyridinyl)methyl]-6-bromo-1,4-benzoxazin-3-one.
| Compound Name | 4-[(4-amino-2-pyridinyl)methyl]-6-bromo-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 79251552 |
| Molecular Formula | C14H12BrN3O2 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 4-[(4-amino-2-pyridinyl)methyl]-6-bromo-1,4-benzoxazin-3-one |
| SMILES | Nc1ccnc(CN2C(=O)COc3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C14H12BrN3O2/c15-9-1-2-13-12(5-9)18(14(19)8-20-13)7-11-6-10(16)3-4-17-11/h1-6H,7-8H2,(H2,16,17) |
| InChIKey | MSWSKSFBMMSYMX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |