About 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile
2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile (PubChem CID 43479505) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile |
| PubChem CID | 43479505 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CN1C(=O)COc2ccc(N)cc21 |
| InChI | InChI=1S/C16H13N3O2/c17-8-11-3-1-2-4-12(11)9-19-14-7-13(18)5-6-15(14)21-10-16(19)20/h1-7H,9-10,18H2 |
| InChIKey | XSCOQNAVBGGQBH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile?
The IUPAC name of 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile (CID 43479505) is 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile.
What is the SMILES notation for 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile?
The canonical SMILES for 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile is N#Cc1ccccc1CN1C(=O)COc2ccc(N)cc21.
What is the InChIKey of 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile?
The InChIKey is XSCOQNAVBGGQBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2/c17-8-11-3-1-2-4-12(11)9-19-14-7-13(18)5-6-15(14)21-10-16(19)20/h1-7H,9-10,18H2.
What are the key properties of 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile?
2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile has a molecular weight of 279.30 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-amino-3-oxo-1,4-benzoxazin-4-yl)methyl]benzonitrile is sourced from PubChem (CID 43479505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).