C17H18N2O5 — CID 42786181
N-(2-methoxyethyl)-5-[(3-oxo-1,4-benzoxazin-4-yl)methyl]furan-2-carboxamide (PubChem CID 42786181) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-[(3-oxo-1,4-benzoxazin-4-yl)methyl]furan-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5-[(3-oxo-1,4-benzoxazin-4-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42786181 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-(2-methoxyethyl)-5-[(3-oxo-1,4-benzoxazin-4-yl)methyl]furan-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(CN2C(=O)COc3ccccc32)o1 |
| InChI | InChI=1S/C17H18N2O5/c1-22-9-8-18-17(21)15-7-6-12(24-15)10-19-13-4-2-3-5-14(13)23-11-16(19)20/h2-7H,8-11H2,1H3,(H,18,21) |
| InChIKey | HBIOQQSZXDDQFI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|