C20H21NO4 — CID 23411118
propan-2-yl 4-[(6-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate (PubChem CID 23411118) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is propan-2-yl 4-[(6-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate.
| Compound Name | propan-2-yl 4-[(6-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate |
|---|---|
| PubChem CID | 23411118 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | propan-2-yl 4-[(6-methyl-3-oxo-1,4-benzoxazin-4-yl)methyl]benzoate |
| SMILES | Cc1ccc2c(c1)N(Cc1ccc(C(=O)OC(C)C)cc1)C(=O)CO2 |
| InChI | InChI=1S/C20H21NO4/c1-13(2)25-20(23)16-7-5-15(6-8-16)11-21-17-10-14(3)4-9-18(17)24-12-19(21)22/h4-10,13H,11-12H2,1-3H3 |
| InChIKey | XVRVECUKQRFVLG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |