C24H26N2O6S — CID 43954957
2-[2-(1,3-benzodioxol-5-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]-N-cyclohexylacetamide (PubChem CID 43954957) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]-N-cyclohexylacetamide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 43954957 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]-N-cyclohexylacetamide |
| SMILES | O=C(CN1C(=O)CC(c2ccc3c(c2)OCO3)S(=O)(=O)c2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C24H26N2O6S/c27-23(25-17-6-2-1-3-7-17)14-26-18-8-4-5-9-21(18)33(29,30)22(13-24(26)28)16-10-11-19-20(12-16)32-15-31-19/h4-5,8-12,17,22H,1-3,6-7,13-15H2,(H,25,27) |
| InChIKey | RYULZXGCAOBAAM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |