C26H24N2O8S — CID 16833426
2-[2-(1,3-benzodioxol-5-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 16833426) has the molecular formula C26H24N2O8S and a molecular weight of 524.55 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16833426 |
| Molecular Formula | C26H24N2O8S |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)CC(c3ccc4c(c3)OCO4)S(=O)(=O)c3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C26H24N2O8S/c1-33-17-8-9-18(21(12-17)34-2)27-25(29)14-28-19-5-3-4-6-23(19)37(31,32)24(13-26(28)30)16-7-10-20-22(11-16)36-15-35-20/h3-12,24H,13-15H2,1-2H3,(H,27,29) |
| InChIKey | SPZLSRGJGVBLPO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |