C28H28N2O8S — CID 43954927
ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]acetyl]amino]benzoate (PubChem CID 43954927) has the molecular formula C28H28N2O8S and a molecular weight of 552.61 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43954927 |
| Molecular Formula | C28H28N2O8S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | ethyl 2-[[2-[2-(3,4-dimethoxyphenyl)-1,1,4-trioxo-2,3-dihydro-1λ6,5-benzothiazepin-5-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CN1C(=O)CC(c2ccc(OC)c(OC)c2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C28H28N2O8S/c1-4-38-28(33)19-9-5-6-10-20(19)29-26(31)17-30-21-11-7-8-12-24(21)39(34,35)25(16-27(30)32)18-13-14-22(36-2)23(15-18)37-3/h5-15,25H,4,16-17H2,1-3H3,(H,29,31) |
| InChIKey | YDLJYPJJZLXJRQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |