C19H12FNO3S — CID 66507232
(5,5-dioxophenothiazin-10-yl)-(4-fluorophenyl)methanone (PubChem CID 66507232) has the molecular formula C19H12FNO3S and a molecular weight of 353.37 g/mol. Its IUPAC name is (5,5-dioxophenothiazin-10-yl)-(4-fluorophenyl)methanone.
| Compound Name | (5,5-dioxophenothiazin-10-yl)-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 66507232 |
| Molecular Formula | C19H12FNO3S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | (5,5-dioxophenothiazin-10-yl)-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1c2ccccc2S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C19H12FNO3S/c20-14-11-9-13(10-12-14)19(22)21-15-5-1-3-7-17(15)25(23,24)18-8-4-2-6-16(18)21/h1-12H |
| InChIKey | QZCQTYMNESVYMS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |