C17H20N4O4 — CID 46356950
1-[2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetyl]piperidine-4-carboxamide (PubChem CID 46356950) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 1-[2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46356950 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-[2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetyl]piperidine-4-carboxamide |
| SMILES | Cn1c(=O)c(=O)n(CC(=O)N2CCC(C(N)=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C17H20N4O4/c1-19-12-4-2-3-5-13(12)21(17(25)16(19)24)10-14(22)20-8-6-11(7-9-20)15(18)23/h2-5,11H,6-10H2,1H3,(H2,18,23) |
| InChIKey | GFPNLMOILJOKIA-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|