C25H26N4O4 — CID 50815816
1-[4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]benzoyl]piperidine-4-carboxamide (PubChem CID 50815816) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-[4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]benzoyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50815816 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-[4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]benzoyl]piperidine-4-carboxamide |
| SMILES | C=CCn1c(=O)c(=O)n(Cc2ccc(C(=O)N3CCC(C(N)=O)CC3)cc2)c2ccccc21 |
| InChI | InChI=1S/C25H26N4O4/c1-2-13-28-20-5-3-4-6-21(20)29(25(33)24(28)32)16-17-7-9-19(10-8-17)23(31)27-14-11-18(12-15-27)22(26)30/h2-10,18H,1,11-16H2,(H2,26,30) |
| InChIKey | NLBLARSSFUEWEU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|