C27H25N3O4 — CID 50817177
4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]-N-[(3-methoxyphenyl)methyl]benzamide (PubChem CID 50817177) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is 4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]-N-[(3-methoxyphenyl)methyl]benzamide.
| Compound Name | 4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]-N-[(3-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 50817177 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]-N-[(3-methoxyphenyl)methyl]benzamide |
| SMILES | C=CCn1c(=O)c(=O)n(Cc2ccc(C(=O)NCc3cccc(OC)c3)cc2)c2ccccc21 |
| InChI | InChI=1S/C27H25N3O4/c1-3-15-29-23-9-4-5-10-24(23)30(27(33)26(29)32)18-19-11-13-21(14-12-19)25(31)28-17-20-7-6-8-22(16-20)34-2/h3-14,16H,1,15,17-18H2,2H3,(H,28,31) |
| InChIKey | BTWGWEZBZVNGOC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|