C27H25N3O3 — CID 50817079
4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]-N-[(3-methylphenyl)methyl]benzamide (PubChem CID 50817079) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]-N-[(3-methylphenyl)methyl]benzamide.
| Compound Name | 4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]-N-[(3-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 50817079 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]-N-[(3-methylphenyl)methyl]benzamide |
| SMILES | C=CCn1c(=O)c(=O)n(Cc2ccc(C(=O)NCc3cccc(C)c3)cc2)c2ccccc21 |
| InChI | InChI=1S/C27H25N3O3/c1-3-15-29-23-9-4-5-10-24(23)30(27(33)26(29)32)18-20-11-13-22(14-12-20)25(31)28-17-21-8-6-7-19(2)16-21/h3-14,16H,1,15,17-18H2,2H3,(H,28,31) |
| InChIKey | QGQHCVDMKJJNQZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|