C20H18FN3O3 — CID 50802505
2-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[(3-fluorophenyl)methyl]acetamide (PubChem CID 50802505) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is 2-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[(3-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[(3-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 50802505 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[(3-fluorophenyl)methyl]acetamide |
| SMILES | C=CCn1c(=O)c(=O)n(CC(=O)NCc2cccc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C20H18FN3O3/c1-2-10-23-16-8-3-4-9-17(16)24(20(27)19(23)26)13-18(25)22-12-14-6-5-7-15(21)11-14/h2-9,11H,1,10,12-13H2,(H,22,25) |
| InChIKey | BXSXRWBIHHFPAQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|