C18H16FN3O3 — CID 17425530
2-(2,4-dioxoquinazolin-1-yl)-N-[2-(3-fluorophenyl)ethyl]acetamide (PubChem CID 17425530) has the molecular formula C18H16FN3O3 and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-(2,4-dioxoquinazolin-1-yl)-N-[2-(3-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(2,4-dioxoquinazolin-1-yl)-N-[2-(3-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 17425530 |
| Molecular Formula | C18H16FN3O3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-(2,4-dioxoquinazolin-1-yl)-N-[2-(3-fluorophenyl)ethyl]acetamide |
| SMILES | O=C(Cn1c(=O)[nH]c(=O)c2ccccc21)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C18H16FN3O3/c19-13-5-3-4-12(10-13)8-9-20-16(23)11-22-15-7-2-1-6-14(15)17(24)21-18(22)25/h1-7,10H,8-9,11H2,(H,20,23)(H,21,24,25) |
| InChIKey | NMUNZAFLRLXNHN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |