C25H28ClN5O3 — CID 50802552
N-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-2-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)acetamide (PubChem CID 50802552) has the molecular formula C25H28ClN5O3 and a molecular weight of 481.98 g/mol. Its IUPAC name is N-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-2-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)acetamide.
| Compound Name | N-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-2-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 50802552 |
| Molecular Formula | C25H28ClN5O3 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | N-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-2-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)acetamide |
| SMILES | C=CCn1c(=O)c(=O)n(CC(=O)NCCN2CCN(c3cccc(Cl)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H28ClN5O3/c1-2-11-30-21-8-3-4-9-22(21)31(25(34)24(30)33)18-23(32)27-10-12-28-13-15-29(16-14-28)20-7-5-6-19(26)17-20/h2-9,17H,1,10-16,18H2,(H,27,32) |
| InChIKey | KWVVMTMZGSAANX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|