C22H23N3O3 — CID 50815573
3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[(3-methylphenyl)methyl]propanamide (PubChem CID 50815573) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[(3-methylphenyl)methyl]propanamide.
| Compound Name | 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[(3-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 50815573 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[(3-methylphenyl)methyl]propanamide |
| SMILES | C=CCn1c(=O)c(=O)n(CCC(=O)NCc2cccc(C)c2)c2ccccc21 |
| InChI | InChI=1S/C22H23N3O3/c1-3-12-24-18-9-4-5-10-19(18)25(22(28)21(24)27)13-11-20(26)23-15-17-8-6-7-16(2)14-17/h3-10,14H,1,11-13,15H2,2H3,(H,23,26) |
| InChIKey | ILXMGCMMECAWFP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|