C28H29N3O4 — CID 50815790
4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[(4-propan-2-yloxyphenyl)methyl]benzamide (PubChem CID 50815790) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[(4-propan-2-yloxyphenyl)methyl]benzamide.
| Compound Name | 4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[(4-propan-2-yloxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 50815790 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]-N-[(4-propan-2-yloxyphenyl)methyl]benzamide |
| SMILES | CCn1c(=O)c(=O)n(Cc2ccc(C(=O)NCc3ccc(OC(C)C)cc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C28H29N3O4/c1-4-30-24-7-5-6-8-25(24)31(28(34)27(30)33)18-21-9-13-22(14-10-21)26(32)29-17-20-11-15-23(16-12-20)35-19(2)3/h5-16,19H,4,17-18H2,1-3H3,(H,29,32) |
| InChIKey | OMFQAUJNBFCFAJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|