C27H27N3O4 — CID 50815625
N-[(2-ethoxyphenyl)methyl]-4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]benzamide (PubChem CID 50815625) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]benzamide.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 50815625 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-4-[(4-ethyl-2,3-dioxoquinoxalin-1-yl)methyl]benzamide |
| SMILES | CCOc1ccccc1CNC(=O)c1ccc(Cn2c(=O)c(=O)n(CC)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H27N3O4/c1-3-29-22-10-6-7-11-23(22)30(27(33)26(29)32)18-19-13-15-20(16-14-19)25(31)28-17-21-9-5-8-12-24(21)34-4-2/h5-16H,3-4,17-18H2,1-2H3,(H,28,31) |
| InChIKey | PWZONBBZYQSGOU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|