C26H25N3O4 — CID 46259328
2-(4-benzyl-2,3-dioxoquinoxalin-1-yl)-N-[2-(3-methoxyphenyl)ethyl]acetamide (PubChem CID 46259328) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-(4-benzyl-2,3-dioxoquinoxalin-1-yl)-N-[2-(3-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-benzyl-2,3-dioxoquinoxalin-1-yl)-N-[2-(3-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 46259328 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-(4-benzyl-2,3-dioxoquinoxalin-1-yl)-N-[2-(3-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1cccc(CCNC(=O)Cn2c(=O)c(=O)n(Cc3ccccc3)c3ccccc32)c1 |
| InChI | InChI=1S/C26H25N3O4/c1-33-21-11-7-10-19(16-21)14-15-27-24(30)18-29-23-13-6-5-12-22(23)28(25(31)26(29)32)17-20-8-3-2-4-9-20/h2-13,16H,14-15,17-18H2,1H3,(H,27,30) |
| InChIKey | UMIMEJQJTWVQKV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|