C26H28N4O3S — CID 4058956
1-[2-[(4-methylphenyl)methylsulfanyl]-4-oxo-3-prop-2-enylquinazoline-7-carbonyl]piperidine-4-carboxamide (PubChem CID 4058956) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is 1-[2-[(4-methylphenyl)methylsulfanyl]-4-oxo-3-prop-2-enylquinazoline-7-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[(4-methylphenyl)methylsulfanyl]-4-oxo-3-prop-2-enylquinazoline-7-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 4058956 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 1-[2-[(4-methylphenyl)methylsulfanyl]-4-oxo-3-prop-2-enylquinazoline-7-carbonyl]piperidine-4-carboxamide |
| SMILES | C=CCn1c(SCc2ccc(C)cc2)nc2cc(C(=O)N3CCC(C(N)=O)CC3)ccc2c1=O |
| InChI | InChI=1S/C26H28N4O3S/c1-3-12-30-25(33)21-9-8-20(24(32)29-13-10-19(11-14-29)23(27)31)15-22(21)28-26(30)34-16-18-6-4-17(2)5-7-18/h3-9,15,19H,1,10-14,16H2,2H3,(H2,27,31) |
| InChIKey | QTSNDUAALDXCEN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|