C27H29N3O5 — CID 92895120
ethyl (3S)-1-[4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]benzoyl]piperidine-3-carboxylate (PubChem CID 92895120) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is ethyl (3S)-1-[4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 92895120 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | ethyl (3S)-1-[4-[(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)methyl]benzoyl]piperidine-3-carboxylate |
| SMILES | C=CCn1c(=O)c(=O)n(Cc2ccc(C(=O)N3CCC[C@H](C(=O)OCC)C3)cc2)c2ccccc21 |
| InChI | InChI=1S/C27H29N3O5/c1-3-15-29-22-9-5-6-10-23(22)30(26(33)25(29)32)17-19-11-13-20(14-12-19)24(31)28-16-7-8-21(18-28)27(34)35-4-2/h3,5-6,9-14,21H,1,4,7-8,15-18H2,2H3/t21-/m0/s1 |
| InChIKey | DANXGTIAVDVZRW-NRFANRHFSA-N |
| XLogP | 2.81 |
| TPSA | 90.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|