C12H11N5O4 — CID 9419984
N-[4-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]phenyl]acetamide (PubChem CID 9419984) has the molecular formula C12H11N5O4 and a molecular weight of 289.25 g/mol. Its IUPAC name is N-[4-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]phenyl]acetamide.
| Compound Name | N-[4-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]phenyl]acetamide |
|---|---|
| PubChem CID | 9419984 |
| Molecular Formula | C12H11N5O4 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | N-[4-[2-(3-nitro-1,2,4-triazol-1-yl)acetyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=O)Cn2cnc([N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C12H11N5O4/c1-8(18)14-10-4-2-9(3-5-10)11(19)6-16-7-13-12(15-16)17(20)21/h2-5,7H,6H2,1H3,(H,14,18) |
| InChIKey | SVSPCQFJSCNBNT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|