C8H9N7O3 — CID 6303006
2-cyano-N-[(E)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]acetamide (PubChem CID 6303006) has the molecular formula C8H9N7O3 and a molecular weight of 251.21 g/mol. Its IUPAC name is 2-cyano-N-[(E)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]acetamide.
| Compound Name | 2-cyano-N-[(E)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]acetamide |
|---|---|
| PubChem CID | 6303006 |
| Molecular Formula | C8H9N7O3 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-cyano-N-[(E)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]acetamide |
| SMILES | C/C(Cn1cnc([N+](=O)[O-])n1)=N\NC(=O)CC#N |
| InChI | InChI=1S/C8H9N7O3/c1-6(11-12-7(16)2-3-9)4-14-5-10-8(13-14)15(17)18/h5H,2,4H2,1H3,(H,12,16)/b11-6+ |
| InChIKey | FHVDKTZYEFDQFC-IZZDOVSWSA-N |
| XLogP | -0.41 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|