C11H14N6O3 — CID 47289941
N-(1-cyanocyclohexyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 47289941) has the molecular formula C11H14N6O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 47289941 |
| Molecular Formula | C11H14N6O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | N#CC1(NC(=O)Cn2cnc([N+](=O)[O-])n2)CCCCC1 |
| InChI | InChI=1S/C11H14N6O3/c12-7-11(4-2-1-3-5-11)14-9(18)6-16-8-13-10(15-16)17(19)20/h8H,1-6H2,(H,14,18) |
| InChIKey | RLQLROWLHVERED-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|