C15H18N6O3 — CID 86913522
N-(1-cyanocyclopentyl)-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide (PubChem CID 86913522) has the molecular formula C15H18N6O3 and a molecular weight of 330.35 g/mol. Its IUPAC name is N-(1-cyanocyclopentyl)-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide.
| Compound Name | N-(1-cyanocyclopentyl)-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide |
|---|---|
| PubChem CID | 86913522 |
| Molecular Formula | C15H18N6O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-(1-cyanocyclopentyl)-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide |
| SMILES | Cn1cnc2c1c(=O)n(CC(=O)NC1(C#N)CCCC1)c(=O)n2C |
| InChI | InChI=1S/C15H18N6O3/c1-19-9-17-12-11(19)13(23)21(14(24)20(12)2)7-10(22)18-15(8-16)5-3-4-6-15/h9H,3-7H2,1-2H3,(H,18,22) |
| InChIKey | FOQPQWLRHQXORI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |