C17H22N6O3 — CID 17445489
N-(1-cyanocyclohexyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide (PubChem CID 17445489) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide |
|---|---|
| PubChem CID | 17445489 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)propanamide |
| SMILES | CC(C(=O)NC1(C#N)CCCCC1)n1cnc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H22N6O3/c1-11(14(24)20-17(9-18)7-5-4-6-8-17)23-10-19-13-12(23)15(25)22(3)16(26)21(13)2/h10-11H,4-8H2,1-3H3,(H,20,24) |
| InChIKey | FFNRAAPDHZCYLK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |