C16H19N7O3 — CID 166409852
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide (PubChem CID 166409852) has the molecular formula C16H19N7O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide |
|---|---|
| PubChem CID | 166409852 |
| Molecular Formula | C16H19N7O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetamide |
| SMILES | C#CCCC1(CCNC(=O)Cn2c(=O)c3c(ncn3C)n(C)c2=O)N=N1 |
| InChI | InChI=1S/C16H19N7O3/c1-4-5-6-16(19-20-16)7-8-17-11(24)9-23-14(25)12-13(18-10-21(12)2)22(3)15(23)26/h1,10H,5-9H2,2-3H3,(H,17,24) |
| InChIKey | YQPOGWHMAQIVBX-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|