About 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride (PubChem CID 120654622) has the molecular formula C14H23ClN6O3
and a molecular weight of 358.83 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride |
| PubChem CID | 120654622 |
| Molecular Formula | C14H23ClN6O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)Cn1c(=O)c2c(ncn2C)n(C)c1=O.Cl |
| InChI | InChI=1S/C14H22N6O3.ClH/c1-5-15-9(2)6-16-10(21)7-20-13(22)11-12(17-8-18(11)3)19(4)14(20)23;/h8-9,15H,5-7H2,1-4H3,(H,16,21);1H/t9-;/m1./s1 |
| InChIKey | MERFCKGTIAHARJ-SBSPUUFOSA-N |
| XLogP | -1.03 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride?
The IUPAC name of 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride (CID 120654622) is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride.
What is the SMILES notation for 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride?
The canonical SMILES for 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride is CCN[C@H](C)CNC(=O)Cn1c(=O)c2c(ncn2C)n(C)c1=O.Cl.
What is the InChIKey of 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride?
The InChIKey is MERFCKGTIAHARJ-SBSPUUFOSA-N. The full InChI is InChI=1S/C14H22N6O3.ClH/c1-5-15-9(2)6-16-10(21)7-20-13(22)11-12(17-8-18(11)3)19(4)14(20)23;/h8-9,15H,5-7H2,1-4H3,(H,16,21);1H/t9-;/m1./s1.
What are the key properties of 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride?
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride has a molecular weight of 358.83 g/mol, XLogP of -1.03, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[(2R)-2-(ethylamino)propyl]acetamide;hydrochloride is sourced from PubChem (CID 120654622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).