C18H29N7O3 — CID 55660023
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide (PubChem CID 55660023) has the molecular formula C18H29N7O3 and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide.
| Compound Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 55660023 |
| Molecular Formula | C18H29N7O3 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]acetamide |
| SMILES | CCN1CCN(CCCNC(=O)Cn2c(=O)c3c(ncn3C)n(C)c2=O)CC1 |
| InChI | InChI=1S/C18H29N7O3/c1-4-23-8-10-24(11-9-23)7-5-6-19-14(26)12-25-17(27)15-16(20-13-21(15)2)22(3)18(25)28/h13H,4-12H2,1-3H3,(H,19,26) |
| InChIKey | AQJVLOIAZYEDPU-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|