C17H26N6O4 — CID 55848555
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-(4-morpholin-4-ylbutyl)acetamide (PubChem CID 55848555) has the molecular formula C17H26N6O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-(4-morpholin-4-ylbutyl)acetamide.
| Compound Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-(4-morpholin-4-ylbutyl)acetamide |
|---|---|
| PubChem CID | 55848555 |
| Molecular Formula | C17H26N6O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-(4-morpholin-4-ylbutyl)acetamide |
| SMILES | Cn1cnc2c1c(=O)n(CC(=O)NCCCCN1CCOCC1)c(=O)n2C |
| InChI | InChI=1S/C17H26N6O4/c1-20-12-19-15-14(20)16(25)23(17(26)21(15)2)11-13(24)18-5-3-4-6-22-7-9-27-10-8-22/h12H,3-11H2,1-2H3,(H,18,24) |
| InChIKey | XIWHCCNKJRMHBK-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|