C20H26N6O3 — CID 17412450
2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[3-(N-ethylanilino)propyl]acetamide (PubChem CID 17412450) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[3-(N-ethylanilino)propyl]acetamide.
| Compound Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[3-(N-ethylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 17412450 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)-N-[3-(N-ethylanilino)propyl]acetamide |
| SMILES | CCN(CCCNC(=O)Cn1c(=O)c2c(ncn2C)n(C)c1=O)c1ccccc1 |
| InChI | InChI=1S/C20H26N6O3/c1-4-25(15-9-6-5-7-10-15)12-8-11-21-16(27)13-26-19(28)17-18(22-14-23(17)2)24(3)20(26)29/h5-7,9-10,14H,4,8,11-13H2,1-3H3,(H,21,27) |
| InChIKey | CZIQJSOMUOEVJT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 94.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|