C10H9BrN6O4 — CID 6379703
5-bromo-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]furan-2-carboxamide (PubChem CID 6379703) has the molecular formula C10H9BrN6O4 and a molecular weight of 357.12 g/mol. Its IUPAC name is 5-bromo-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 6379703 |
| Molecular Formula | C10H9BrN6O4 |
| Molecular Weight | 357.12 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 5-bromo-N-[(Z)-1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]furan-2-carboxamide |
| SMILES | C/C(Cn1cnc([N+](=O)[O-])n1)=N/NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C10H9BrN6O4/c1-6(4-16-5-12-10(15-16)17(19)20)13-14-9(18)7-2-3-8(11)21-7/h2-3,5H,4H2,1H3,(H,14,18)/b13-6- |
| InChIKey | JPJIIYUDJYADIN-MLPAPPSSSA-N |
| XLogP | 1.35 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.12 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|