C14H16BrN5O3 — CID 86834491
N-[4-(4-bromophenyl)butan-2-yl]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 86834491) has the molecular formula C14H16BrN5O3 and a molecular weight of 382.22 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)butan-2-yl]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[4-(4-bromophenyl)butan-2-yl]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 86834491 |
| Molecular Formula | C14H16BrN5O3 |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | N-[4-(4-bromophenyl)butan-2-yl]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | CC(CCc1ccc(Br)cc1)NC(=O)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H16BrN5O3/c1-10(2-3-11-4-6-12(15)7-5-11)17-13(21)8-19-9-16-14(18-19)20(22)23/h4-7,9-10H,2-3,8H2,1H3,(H,17,21) |
| InChIKey | XCWHDRFJQNIRBT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|