C13H13N7O6 — CID 3278643
2-(4-nitrophenoxy)-N-[1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]acetamide (PubChem CID 3278643) has the molecular formula C13H13N7O6 and a molecular weight of 363.29 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-N-[1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]acetamide.
| Compound Name | 2-(4-nitrophenoxy)-N-[1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]acetamide |
|---|---|
| PubChem CID | 3278643 |
| Molecular Formula | C13H13N7O6 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 2-(4-nitrophenoxy)-N-[1-(3-nitro-1,2,4-triazol-1-yl)propan-2-ylideneamino]acetamide |
| SMILES | CC(Cn1cnc([N+](=O)[O-])n1)=NNC(=O)COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H13N7O6/c1-9(6-18-8-14-13(17-18)20(24)25)15-16-12(21)7-26-11-4-2-10(3-5-11)19(22)23/h2-5,8H,6-7H2,1H3,(H,16,21) |
| InChIKey | OJDHHPUKEZCRHG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 167.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|