C16H16N4O4 — CID 909337
N-[1-(4-aminophenyl)ethylideneamino]-2-(4-nitrophenoxy)acetamide (PubChem CID 909337) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)ethylideneamino]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[1-(4-aminophenyl)ethylideneamino]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 909337 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-[1-(4-aminophenyl)ethylideneamino]-2-(4-nitrophenoxy)acetamide |
| SMILES | CC(=NNC(=O)COc1ccc([N+](=O)[O-])cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H16N4O4/c1-11(12-2-4-13(17)5-3-12)18-19-16(21)10-24-15-8-6-14(7-9-15)20(22)23/h2-9H,10,17H2,1H3,(H,19,21) |
| InChIKey | AIBDIUBDIYUXPA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|