C21H17ClN4O5S — CID 6028075
5-chloro-N-[4-[(Z)-C-methyl-N-[[2-(4-nitrophenoxy)acetyl]amino]carbonimidoyl]phenyl]thiophene-2-carboxamide (PubChem CID 6028075) has the molecular formula C21H17ClN4O5S and a molecular weight of 472.91 g/mol. Its IUPAC name is 5-chloro-N-[4-[(Z)-C-methyl-N-[[2-(4-nitrophenoxy)acetyl]amino]carbonimidoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[4-[(Z)-C-methyl-N-[[2-(4-nitrophenoxy)acetyl]amino]carbonimidoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6028075 |
| Molecular Formula | C21H17ClN4O5S |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 5-chloro-N-[4-[(Z)-C-methyl-N-[[2-(4-nitrophenoxy)acetyl]amino]carbonimidoyl]phenyl]thiophene-2-carboxamide |
| SMILES | C/C(=N/NC(=O)COc1ccc([N+](=O)[O-])cc1)c1ccc(NC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C21H17ClN4O5S/c1-13(24-25-20(27)12-31-17-8-6-16(7-9-17)26(29)30)14-2-4-15(5-3-14)23-21(28)18-10-11-19(22)32-18/h2-11H,12H2,1H3,(H,23,28)(H,25,27)/b24-13- |
| InChIKey | WUBNARRNGPTPLM-CFRMEGHHSA-N |
| XLogP | 4.48 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|