C12H16N2O3S — CID 88523699
N-methyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]methanethioamide (PubChem CID 88523699) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-methyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]methanethioamide.
| Compound Name | N-methyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]methanethioamide |
|---|---|
| PubChem CID | 88523699 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | N-methyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]methanethioamide |
| SMILES | COc1cc(C=NN(C)C=S)cc(OC)c1OC |
| InChI | InChI=1S/C12H16N2O3S/c1-14(8-18)13-7-9-5-10(15-2)12(17-4)11(6-9)16-3/h5-8H,1-4H3 |
| InChIKey | BJVVFEVCRDMGNQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|