C11H16N4O3 — CID 22302286
N'-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]methanimidamide (PubChem CID 22302286) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is N'-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]methanimidamide.
| Compound Name | N'-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]methanimidamide |
|---|---|
| PubChem CID | 22302286 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N'-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]methanimidamide |
| SMILES | COc1cc(/C=N/N/N=C\N)cc(OC)c1OC |
| InChI | InChI=1S/C11H16N4O3/c1-16-9-4-8(6-13-15-14-7-12)5-10(17-2)11(9)18-3/h4-7,15H,1-3H3,(H2,12,14)/b13-6+ |
| InChIKey | LYBJFOZJVILTSD-AWNIVKPZSA-N |
| XLogP | 0.54 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|