About N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine
N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine (PubChem CID 59899220) has the molecular formula C13H16N4O3
and a molecular weight of 276.30 g/mol. Its IUPAC name is N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine |
| PubChem CID | 59899220 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine |
| SMILES | COc1cc(C=NNc2ncc[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C13H16N4O3/c1-18-10-6-9(7-11(19-2)12(10)20-3)8-16-17-13-14-4-5-15-13/h4-8H,1-3H3,(H2,14,15,17) |
| InChIKey | FPVMWXNEGMGHSW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine?
The IUPAC name of N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine (CID 59899220) is N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine.
What is the SMILES notation for N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine?
The canonical SMILES for N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine is COc1cc(C=NNc2ncc[nH]2)cc(OC)c1OC.
What is the InChIKey of N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine?
The InChIKey is FPVMWXNEGMGHSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O3/c1-18-10-6-9(7-11(19-2)12(10)20-3)8-16-17-13-14-4-5-15-13/h4-8H,1-3H3,(H2,14,15,17).
What are the key properties of N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine?
N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine has a molecular weight of 276.30 g/mol, XLogP of 1.88, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4,5-trimethoxyphenyl)methylideneamino]-1H-imidazol-2-amine is sourced from PubChem (CID 59899220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).