C14H14N4O4 — CID 45031273
5-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile (PubChem CID 45031273) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is 5-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 45031273 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
| SMILES | COc1cc(/C=N/Nc2ocnc2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C14H14N4O4/c1-19-11-4-9(5-12(20-2)13(11)21-3)7-17-18-14-10(6-15)16-8-22-14/h4-5,7-8,18H,1-3H3/b17-7+ |
| InChIKey | BPZFRHVIUQRTTD-REZTVBANSA-N |
| XLogP | 2.02 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|