C23H23N5O5 — CID 10813400
4-(4-methoxyphenyl)-1-methyl-6-oxo-2-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrimidine-5-carbonitrile (PubChem CID 10813400) has the molecular formula C23H23N5O5 and a molecular weight of 449.47 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-methyl-6-oxo-2-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-methoxyphenyl)-1-methyl-6-oxo-2-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 10813400 |
| Molecular Formula | C23H23N5O5 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-methyl-6-oxo-2-[(2E)-2-[(3,4,5-trimethoxyphenyl)methylidene]hydrazinyl]pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(-c2nc(N/N=C/c3cc(OC)c(OC)c(OC)c3)n(C)c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C23H23N5O5/c1-28-22(29)17(12-24)20(15-6-8-16(30-2)9-7-15)26-23(28)27-25-13-14-10-18(31-3)21(33-5)19(11-14)32-4/h6-11,13H,1-5H3,(H,26,27)/b25-13+ |
| InChIKey | OUZIYWBBNLFVAW-DHRITJCHSA-N |
| XLogP | 2.80 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|