C17H20N2O3 — CID 6258839
4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline (PubChem CID 6258839) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline.
| Compound Name | 4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 6258839 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 4-methyl-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]aniline |
| SMILES | COc1cc(/C=N\Nc2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H20N2O3/c1-12-5-7-14(8-6-12)19-18-11-13-9-15(20-2)17(22-4)16(10-13)21-3/h5-11,19H,1-4H3/b18-11- |
| InChIKey | PVPXUAITIPNEMI-WQRHYEAKSA-N |
| XLogP | 3.47 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|